About 5-carboxypyridin-3-olate
5-carboxypyridin-3-olate (PubChem CID 54708826) has the molecular formula C6H4NO3-
and a molecular weight of 138.10 g/mol. Its IUPAC name is 5-carboxypyridin-3-olate.
Molecular Properties
| Compound Name | 5-carboxypyridin-3-olate |
| PubChem CID | 54708826 |
| Molecular Formula | C6H4NO3- |
| Molecular Weight | 138.10 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 5-carboxypyridin-3-olate |
| SMILES | O=C(O)c1cncc([O-])c1 |
| InChI | InChI=1S/C6H5NO3/c8-5-1-4(6(9)10)2-7-3-5/h1-3,8H,(H,9,10)/p-1 |
| InChIKey | ATTDCVLRGFEHEO-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.10 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-carboxypyridin-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-carboxypyridin-3-olate?
The IUPAC name of 5-carboxypyridin-3-olate (CID 54708826) is 5-carboxypyridin-3-olate.
What is the SMILES notation for 5-carboxypyridin-3-olate?
The canonical SMILES for 5-carboxypyridin-3-olate is O=C(O)c1cncc([O-])c1.
What is the InChIKey of 5-carboxypyridin-3-olate?
The InChIKey is ATTDCVLRGFEHEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO3/c8-5-1-4(6(9)10)2-7-3-5/h1-3,8H,(H,9,10)/p-1.
What are the key properties of 5-carboxypyridin-3-olate?
5-carboxypyridin-3-olate has a molecular weight of 138.10 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-carboxypyridin-3-olate is sourced from PubChem (CID 54708826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).