About 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one
5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one (PubChem CID 54708956) has the molecular formula C19H17NO2
and a molecular weight of 291.35 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one |
| PubChem CID | 54708956 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one |
| SMILES | CCc1c(O)cc(=O)n(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H17NO2/c1-2-16-17(21)13-18(22)20(15-11-7-4-8-12-15)19(16)14-9-5-3-6-10-14/h3-13,21H,2H2,1H3 |
| InChIKey | SOYMRIKAPSBFNE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one?
The IUPAC name of 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one (CID 54708956) is 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one.
What is the SMILES notation for 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one?
The canonical SMILES for 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one is CCc1c(O)cc(=O)n(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one?
The InChIKey is SOYMRIKAPSBFNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO2/c1-2-16-17(21)13-18(22)20(15-11-7-4-8-12-15)19(16)14-9-5-3-6-10-14/h3-13,21H,2H2,1H3.
What are the key properties of 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one?
5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one has a molecular weight of 291.35 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-hydroxy-1,6-diphenylpyridin-2-one is sourced from PubChem (CID 54708956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).