C21H19NO2 — CID 54708975
4-hydroxy-1,3-diphenyl-5,6,7,8-tetrahydroquinolin-2-one (PubChem CID 54708975) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-hydroxy-1,3-diphenyl-5,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 4-hydroxy-1,3-diphenyl-5,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 54708975 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-hydroxy-1,3-diphenyl-5,6,7,8-tetrahydroquinolin-2-one |
| SMILES | O=c1c(-c2ccccc2)c(O)c2c(n1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C21H19NO2/c23-20-17-13-7-8-14-18(17)22(16-11-5-2-6-12-16)21(24)19(20)15-9-3-1-4-10-15/h1-6,9-12,23H,7-8,13-14H2 |
| InChIKey | NQTBPAHDTQHICD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |