C18H12F2O4 — CID 5470986
(1Z,5Z)-1,6-bis(4-fluorophenyl)-1,6-dihydroxyhexa-1,5-diene-3,4-dione (PubChem CID 5470986) has the molecular formula C18H12F2O4 and a molecular weight of 330.29 g/mol. Its IUPAC name is (1Z,5Z)-1,6-bis(4-fluorophenyl)-1,6-dihydroxyhexa-1,5-diene-3,4-dione.
| Compound Name | (1Z,5Z)-1,6-bis(4-fluorophenyl)-1,6-dihydroxyhexa-1,5-diene-3,4-dione |
|---|---|
| PubChem CID | 5470986 |
| Molecular Formula | C18H12F2O4 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (1Z,5Z)-1,6-bis(4-fluorophenyl)-1,6-dihydroxyhexa-1,5-diene-3,4-dione |
| SMILES | O=C(/C=C(\O)c1ccc(F)cc1)C(=O)/C=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H12F2O4/c19-13-5-1-11(2-6-13)15(21)9-17(23)18(24)10-16(22)12-3-7-14(20)8-4-12/h1-10,21-22H/b15-9-,16-10- |
| InChIKey | VBSRFAACBOQOMV-VULZFCBJSA-N |
| XLogP | 3.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|