About 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one
4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one (PubChem CID 54709936) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one |
| PubChem CID | 54709936 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(CS)NC1=O |
| InChI | InChI=1S/C7H9NO3S/c1-3(9)5-6(10)4(2-12)8-7(5)11/h4,10,12H,2H2,1H3,(H,8,11) |
| InChIKey | MNXPOGKDIRHPND-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one (CID 54709936) is 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one is CC(=O)C1=C(O)C(CS)NC1=O.
What is the InChIKey of 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one?
The InChIKey is MNXPOGKDIRHPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-3(9)5-6(10)4(2-12)8-7(5)11/h4,10,12H,2H2,1H3,(H,8,11).
What are the key properties of 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one?
4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one has a molecular weight of 187.22 g/mol, XLogP of -0.18, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-3-hydroxy-2-(sulfanylmethyl)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 54709936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).