About 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione
4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione (PubChem CID 54710007) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione.
Molecular Properties
| Compound Name | 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione |
| PubChem CID | 54710007 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione |
| SMILES | O=C1CCCc2oc(=O)cc(O)c21 |
| InChI | InChI=1S/C9H8O4/c10-5-2-1-3-7-9(5)6(11)4-8(12)13-7/h4,11H,1-3H2 |
| InChIKey | UJHANGLXDWJMTJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione?
The IUPAC name of 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione (CID 54710007) is 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione.
What is the SMILES notation for 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione?
The canonical SMILES for 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione is O=C1CCCc2oc(=O)cc(O)c21.
What is the InChIKey of 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione?
The InChIKey is UJHANGLXDWJMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c10-5-2-1-3-7-9(5)6(11)4-8(12)13-7/h4,11H,1-3H2.
What are the key properties of 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione?
4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione has a molecular weight of 180.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-7,8-dihydro-6H-chromene-2,5-dione is sourced from PubChem (CID 54710007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).