C34H48N2O2 — CID 5471013
[(3S,8R,9S,10R,13S,14S,16E,17S)-16-[[4-(dimethylamino)phenyl]methylidene]-10,13-dimethyl-3-pyrrolidin-1-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 5471013) has the molecular formula C34H48N2O2 and a molecular weight of 516.77 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,16E,17S)-16-[[4-(dimethylamino)phenyl]methylidene]-10,13-dimethyl-3-pyrrolidin-1-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,16E,17S)-16-[[4-(dimethylamino)phenyl]methylidene]-10,13-dimethyl-3-pyrrolidin-1-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 5471013 |
| Molecular Formula | C34H48N2O2 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,16E,17S)-16-[[4-(dimethylamino)phenyl]methylidene]-10,13-dimethyl-3-pyrrolidin-1-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C(=C/c2ccc(N(C)C)cc2)C[C@H]2[C@@H]3CC=C4C[C@@H](N5CCCC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H48N2O2/c1-23(37)38-32-25(20-24-8-11-27(12-9-24)35(4)5)21-31-29-13-10-26-22-28(36-18-6-7-19-36)14-16-33(26,2)30(29)15-17-34(31,32)3/h8-12,20,28-32H,6-7,13-19,21-22H2,1-5H3/b25-20+/t28-,29+,30-,31-,32-,33-,34-/m0/s1 |
| InChIKey | DQGRKGXQBAWZMX-ZSSAHIQMSA-N |
| XLogP | 7.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|