C29H26F3N3O3S — CID 5471040
N,N-dimethyl-4-[(Z)-[1-methyl-2-[(E)-2-phenylethenyl]pyrazolo[1,5-a]indol-1-ium-4-ylidene]methyl]aniline;trifluoromethanesulfonate (PubChem CID 5471040) has the molecular formula C29H26F3N3O3S and a molecular weight of 553.61 g/mol. Its IUPAC name is N,N-dimethyl-4-[(Z)-[1-methyl-2-[(E)-2-phenylethenyl]pyrazolo[1,5-a]indol-1-ium-4-ylidene]methyl]aniline;trifluoromethanesulfonate.
| Compound Name | N,N-dimethyl-4-[(Z)-[1-methyl-2-[(E)-2-phenylethenyl]pyrazolo[1,5-a]indol-1-ium-4-ylidene]methyl]aniline;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 5471040 |
| Molecular Formula | C29H26F3N3O3S |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | N,N-dimethyl-4-[(Z)-[1-methyl-2-[(E)-2-phenylethenyl]pyrazolo[1,5-a]indol-1-ium-4-ylidene]methyl]aniline;trifluoromethanesulfonate |
| SMILES | CN(C)c1ccc(/C=c2/c3ccccc3n3c2cc(/C=C/c2ccccc2)[n+]3C)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H26N3.CHF3O3S/c1-29(2)23-16-14-22(15-17-23)19-26-25-11-7-8-12-27(25)31-28(26)20-24(30(31)3)18-13-21-9-5-4-6-10-21;2-1(3,4)8(5,6)7/h4-20H,1-3H3;(H,5,6,7)/q+1;/p-1/b18-13+; |
| InChIKey | PSROBECGVMEYHD-PUBYZPQMSA-M |
| XLogP | 4.75 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|