About l-ascorbic acid-2-phosphate magnesium salt
l-ascorbic acid-2-phosphate magnesium salt (PubChem CID 54710612) has the molecular formula C6H9MgO9P
and a molecular weight of 280.41 g/mol.
Molecular Properties
| Compound Name | l-ascorbic acid-2-phosphate magnesium salt |
| PubChem CID | 54710612 |
| Molecular Formula | C6H9MgO9P |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | — |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1OP(=O)(O)O.[Mg] |
| InChI | InChI=1S/C6H9O9P.Mg/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;/h2,4,7-9H,1H2,(H2,11,12,13);/t2-,4+;/m0./s1 |
| InChIKey | XYWDYAVMJYSSSG-LEJBHHMKSA-N |
| XLogP | -2.24 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze l-ascorbic acid-2-phosphate magnesium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of l-ascorbic acid-2-phosphate magnesium salt?
The IUPAC name of l-ascorbic acid-2-phosphate magnesium salt (CID 54710612) is not available.
What is the SMILES notation for l-ascorbic acid-2-phosphate magnesium salt?
The canonical SMILES for l-ascorbic acid-2-phosphate magnesium salt is O=C1O[C@H]([C@@H](O)CO)C(O)=C1OP(=O)(O)O.[Mg].
What is the InChIKey of l-ascorbic acid-2-phosphate magnesium salt?
The InChIKey is XYWDYAVMJYSSSG-LEJBHHMKSA-N. The full InChI is InChI=1S/C6H9O9P.Mg/c7-1-2(8)4-3(9)5(6(10)14-4)15-16(11,12)13;/h2,4,7-9H,1H2,(H2,11,12,13);/t2-,4+;/m0./s1.
What are the key properties of l-ascorbic acid-2-phosphate magnesium salt?
l-ascorbic acid-2-phosphate magnesium salt has a molecular weight of 280.41 g/mol, XLogP of -2.24, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for l-ascorbic acid-2-phosphate magnesium salt is sourced from PubChem (CID 54710612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).