About 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole
5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole (PubChem CID 5471110) has the molecular formula C16H14O3
and a molecular weight of 254.28 g/mol. Its IUPAC name is 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole |
| PubChem CID | 5471110 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole |
| SMILES | COc1ccc(/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H14O3/c1-17-14-7-4-12(5-8-14)2-3-13-6-9-15-16(10-13)19-11-18-15/h2-10H,11H2,1H3/b3-2+ |
| InChIKey | ILVCMPNWTZNQMO-NSCUHMNNSA-N |
| XLogP | 3.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole?
The IUPAC name of 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole (CID 5471110) is 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole.
What is the SMILES notation for 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole?
The canonical SMILES for 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole is COc1ccc(/C=C/c2ccc3c(c2)OCO3)cc1.
What is the InChIKey of 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole?
The InChIKey is ILVCMPNWTZNQMO-NSCUHMNNSA-N. The full InChI is InChI=1S/C16H14O3/c1-17-14-7-4-12(5-8-14)2-3-13-6-9-15-16(10-13)19-11-18-15/h2-10H,11H2,1H3/b3-2+.
What are the key properties of 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole?
5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole has a molecular weight of 254.28 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(4-methoxyphenyl)ethenyl]-1,3-benzodioxole is sourced from PubChem (CID 5471110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).