C29H41N3O2 — CID 5471113
4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-methoxyphenyl)methyl]-N-pentan-3-ylbenzamide (PubChem CID 5471113) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is 4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-methoxyphenyl)methyl]-N-pentan-3-ylbenzamide.
| Compound Name | 4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-methoxyphenyl)methyl]-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 5471113 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | 4-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-methoxyphenyl)methyl]-N-pentan-3-ylbenzamide |
| SMILES | C=CCN1C[C@H](C)N(C(c2ccc(C(=O)NC(CC)CC)cc2)c2cccc(OC)c2)C[C@H]1C |
| InChI | InChI=1S/C29H41N3O2/c1-7-17-31-19-22(5)32(20-21(31)4)28(25-11-10-12-27(18-25)34-6)23-13-15-24(16-14-23)29(33)30-26(8-2)9-3/h7,10-16,18,21-22,26,28H,1,8-9,17,19-20H2,2-6H3,(H,30,33)/t21-,22+,28?/m1/s1 |
| InChIKey | CFWRGFJCHUHGTL-YDOMFUIGSA-N |
| XLogP | 5.28 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|