C32H35F2NO3 — CID 54711544
5-[1-(3-aminophenyl)-2,2-dimethylpropyl]-2,2-bis[2-(4-fluorophenyl)ethyl]-4-hydroxy-3H-pyran-6-one (PubChem CID 54711544) has the molecular formula C32H35F2NO3 and a molecular weight of 519.63 g/mol. Its IUPAC name is 5-[1-(3-aminophenyl)-2,2-dimethylpropyl]-2,2-bis[2-(4-fluorophenyl)ethyl]-4-hydroxy-3H-pyran-6-one.
| Compound Name | 5-[1-(3-aminophenyl)-2,2-dimethylpropyl]-2,2-bis[2-(4-fluorophenyl)ethyl]-4-hydroxy-3H-pyran-6-one |
|---|---|
| PubChem CID | 54711544 |
| Molecular Formula | C32H35F2NO3 |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 5-[1-(3-aminophenyl)-2,2-dimethylpropyl]-2,2-bis[2-(4-fluorophenyl)ethyl]-4-hydroxy-3H-pyran-6-one |
| SMILES | CC(C)(C)C(C1=C(O)CC(CCc2ccc(F)cc2)(CCc2ccc(F)cc2)OC1=O)c1cccc(N)c1 |
| InChI | InChI=1S/C32H35F2NO3/c1-31(2,3)29(23-5-4-6-26(35)19-23)28-27(36)20-32(38-30(28)37,17-15-21-7-11-24(33)12-8-21)18-16-22-9-13-25(34)14-10-22/h4-14,19,29,36H,15-18,20,35H2,1-3H3 |
| InChIKey | KMORBVODESFOPI-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|