C26H20N2O5S — CID 54711605
6-[[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]methylsulfonyl]pyridine-3-carbonitrile (PubChem CID 54711605) has the molecular formula C26H20N2O5S and a molecular weight of 472.52 g/mol. Its IUPAC name is 6-[[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]methylsulfonyl]pyridine-3-carbonitrile.
| Compound Name | 6-[[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]methylsulfonyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 54711605 |
| Molecular Formula | C26H20N2O5S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 6-[[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]methylsulfonyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)Cc2cccc(C(c3c(O)c4ccccc4oc3=O)C3CC3)c2)nc1 |
| InChI | InChI=1S/C26H20N2O5S/c27-13-17-8-11-22(28-14-17)34(31,32)15-16-4-3-5-19(12-16)23(18-9-10-18)24-25(29)20-6-1-2-7-21(20)33-26(24)30/h1-8,11-12,14,18,23,29H,9-10,15H2 |
| InChIKey | GSTUBFJZGFVJHZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|