C36H45N5O10S2 — CID 54711631
2-[[9-[3-[5-[[3-(1H-benzimidazol-2-ylsulfonylamino)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-2,9-dioxononyl]amino]ethanesulfonic acid (PubChem CID 54711631) has the molecular formula C36H45N5O10S2 and a molecular weight of 771.91 g/mol. Its IUPAC name is 2-[[9-[3-[5-[[3-(1H-benzimidazol-2-ylsulfonylamino)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-2,9-dioxononyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[9-[3-[5-[[3-(1H-benzimidazol-2-ylsulfonylamino)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-2,9-dioxononyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 54711631 |
| Molecular Formula | C36H45N5O10S2 |
| Molecular Weight | 771.91 g/mol |
| Exact Mass | 771.26 |
| IUPAC Name | 2-[[9-[3-[5-[[3-(1H-benzimidazol-2-ylsulfonylamino)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-2,9-dioxononyl]amino]ethanesulfonic acid |
| SMILES | O=C(CCCCCCC(=O)NCCCc1cc(O)c(C(c2cccc(NS(=O)(=O)c3nc4ccccc4[nH]3)c2)C2CC2)c(=O)o1)CNCCS(=O)(=O)O |
| InChI | InChI=1S/C36H45N5O10S2/c42-27(23-37-19-20-52(46,47)48)11-3-1-2-4-15-32(44)38-18-8-12-28-22-31(43)34(35(45)51-28)33(24-16-17-24)25-9-7-10-26(21-25)41-53(49,50)36-39-29-13-5-6-14-30(29)40-36/h5-7,9-10,13-14,21-22,24,33,37,41,43H,1-4,8,11-12,15-20,23H2,(H,38,44)(H,39,40)(H,46,47,48) |
| InChIKey | RBDGYBAPJHCCBY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 237.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|