C16H14NO5- — CID 54711881
2-carboxy-4-[[(2R)-2-phenoxypropanoyl]amino]phenolate (PubChem CID 54711881) has the molecular formula C16H14NO5- and a molecular weight of 300.29 g/mol. Its IUPAC name is 2-carboxy-4-[[(2R)-2-phenoxypropanoyl]amino]phenolate.
| Compound Name | 2-carboxy-4-[[(2R)-2-phenoxypropanoyl]amino]phenolate |
|---|---|
| PubChem CID | 54711881 |
| Molecular Formula | C16H14NO5- |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-carboxy-4-[[(2R)-2-phenoxypropanoyl]amino]phenolate |
| SMILES | C[C@@H](Oc1ccccc1)C(=O)Nc1ccc([O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C16H15NO5/c1-10(22-12-5-3-2-4-6-12)15(19)17-11-7-8-14(18)13(9-11)16(20)21/h2-10,18H,1H3,(H,17,19)(H,20,21)/p-1/t10-/m1/s1 |
| InChIKey | OUQGQHDRYGZFFG-SNVBAGLBSA-M |
| XLogP | 1.86 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |