About 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole
3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole (PubChem CID 5471218) has the molecular formula C23H17N3OS
and a molecular weight of 383.48 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole |
| PubChem CID | 5471218 |
| Molecular Formula | C23H17N3OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole |
| SMILES | COc1ccc(-c2cn3c(nc4ccccc43)c(/C=C/c3cccs3)n2)cc1 |
| InChI | InChI=1S/C23H17N3OS/c1-27-17-10-8-16(9-11-17)21-15-26-22-7-3-2-6-19(22)25-23(26)20(24-21)13-12-18-5-4-14-28-18/h2-15H,1H3/b13-12+ |
| InChIKey | UMZLUAOYYKUESL-OUKQBFOZSA-N |
| XLogP | 5.79 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole?
The IUPAC name of 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole (CID 5471218) is 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole.
What is the SMILES notation for 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole?
The canonical SMILES for 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole is COc1ccc(-c2cn3c(nc4ccccc43)c(/C=C/c3cccs3)n2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole?
The InChIKey is UMZLUAOYYKUESL-OUKQBFOZSA-N. The full InChI is InChI=1S/C23H17N3OS/c1-27-17-10-8-16(9-11-17)21-15-26-22-7-3-2-6-19(22)25-23(26)20(24-21)13-12-18-5-4-14-28-18/h2-15H,1H3/b13-12+.
What are the key properties of 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole?
3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole has a molecular weight of 383.48 g/mol, XLogP of 5.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1-[(E)-2-thiophen-2-ylethenyl]pyrazino[1,2-a]benzimidazole is sourced from PubChem (CID 5471218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).