C30H54O6 — CID 5471233
[(9Z,17Z)-24-(3-hydroxypropanoyloxy)tetracosa-9,17-dienyl] 3-hydroxypropanoate (PubChem CID 5471233) has the molecular formula C30H54O6 and a molecular weight of 510.76 g/mol. Its IUPAC name is [(9Z,17Z)-24-(3-hydroxypropanoyloxy)tetracosa-9,17-dienyl] 3-hydroxypropanoate.
| Compound Name | [(9Z,17Z)-24-(3-hydroxypropanoyloxy)tetracosa-9,17-dienyl] 3-hydroxypropanoate |
|---|---|
| PubChem CID | 5471233 |
| Molecular Formula | C30H54O6 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | [(9Z,17Z)-24-(3-hydroxypropanoyloxy)tetracosa-9,17-dienyl] 3-hydroxypropanoate |
| SMILES | O=C(CCO)OCCCCCC/C=C\CCCCCC/C=C\CCCCCCCCOC(=O)CCO |
| InChI | InChI=1S/C30H54O6/c31-25-23-29(33)35-27-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-28-36-30(34)24-26-32/h5,7,10,12,31-32H,1-4,6,8-9,11,13-28H2/b7-5-,12-10- |
| InChIKey | DCXZDDNUTNOVOS-PSVOIDRLSA-N |
| XLogP | 6.97 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|