C29H30ClN5O8 — CID 54712675
6-[[[4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carbonyl]amino]methylamino]pyridine-3-carboxamide;hydrochloride (PubChem CID 54712675) has the molecular formula C29H30ClN5O8 and a molecular weight of 612.04 g/mol. Its IUPAC name is 6-[[[4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carbonyl]amino]methylamino]pyridine-3-carboxamide;hydrochloride.
| Compound Name | 6-[[[4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carbonyl]amino]methylamino]pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 54712675 |
| Molecular Formula | C29H30ClN5O8 |
| Molecular Weight | 612.04 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | 6-[[[4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carbonyl]amino]methylamino]pyridine-3-carboxamide;hydrochloride |
| SMILES | Cc1c2c(c(O)c3c(O)cccc13)C(=O)C1(O)C(O)=C(C(=O)NCNc3ccc(C(N)=O)cn3)C(=O)C(N(C)C)C1C2.Cl |
| InChI | InChI=1S/C29H29N5O8.ClH/c1-12-14-5-4-6-17(35)19(14)23(36)20-15(12)9-16-22(34(2)3)24(37)21(26(39)29(16,42)25(20)38)28(41)33-11-32-18-8-7-13(10-31-18)27(30)40;/h4-8,10,16,22,35-36,39,42H,9,11H2,1-3H3,(H2,30,40)(H,31,32)(H,33,41);1H |
| InChIKey | YMSQUKXYLYXJSX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 215.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.04 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|