About 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one
4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one (PubChem CID 54712720) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one |
| PubChem CID | 54712720 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one |
| SMILES | COc1cc2[nH]c(=O)cc(O)c2cc1OC |
| InChI | InChI=1S/C11H11NO4/c1-15-9-3-6-7(4-10(9)16-2)12-11(14)5-8(6)13/h3-5H,1-2H3,(H2,12,13,14) |
| InChIKey | FGPCWYCOKWFRNK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one?
The IUPAC name of 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one (CID 54712720) is 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one.
What is the SMILES notation for 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one?
The canonical SMILES for 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one is COc1cc2[nH]c(=O)cc(O)c2cc1OC.
What is the InChIKey of 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one?
The InChIKey is FGPCWYCOKWFRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-15-9-3-6-7(4-10(9)16-2)12-11(14)5-8(6)13/h3-5H,1-2H3,(H2,12,13,14).
What are the key properties of 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one?
4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one has a molecular weight of 221.21 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-6,7-dimethoxy-1H-quinolin-2-one is sourced from PubChem (CID 54712720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).