C21H25N3O5 — CID 54713258
N-[(3,4-dimethylphenyl)methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide (PubChem CID 54713258) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide |
|---|---|
| PubChem CID | 54713258 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2nc3n(c(=O)c2O)CCOC32CCOCC2)cc1C |
| InChI | InChI=1S/C21H25N3O5/c1-13-3-4-15(11-14(13)2)12-22-18(26)16-17(25)19(27)24-7-10-29-21(20(24)23-16)5-8-28-9-6-21/h3-4,11,25H,5-10,12H2,1-2H3,(H,22,26) |
| InChIKey | LZCIGLHLXUMOAT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |