C27H34N2O8S — CID 54713397
(4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(3-methylbutylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54713397) has the molecular formula C27H34N2O8S and a molecular weight of 546.64 g/mol. Its IUPAC name is (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(3-methylbutylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(3-methylbutylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54713397 |
| Molecular Formula | C27H34N2O8S |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (4S,5S,6R,12aR)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-(3-methylbutylsulfanylmethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)CCSC[C@H]1c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C(O)C21 |
| InChI | InChI=1S/C27H34N2O8S/c1-11(2)8-9-38-10-13-12-6-5-7-14(30)15(12)21(31)17-16(13)22(32)19-20(29(3)4)23(33)18(26(28)36)25(35)27(19,37)24(17)34/h5-7,11,13,16,19-20,22,30-32,35,37H,8-10H2,1-4H3,(H2,28,36)/t13-,16?,19?,20-,22?,27-/m0/s1 |
| InChIKey | ZMZCUQAXKSMIIS-RFTGEMHMSA-N |
| XLogP | 1.26 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|