C22H23F2N3O5 — CID 54713658
(3R,6S)-6-[(2S)-butan-2-yl]-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 54713658) has the molecular formula C22H23F2N3O5 and a molecular weight of 447.44 g/mol. Its IUPAC name is (3R,6S)-6-[(2S)-butan-2-yl]-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | (3R,6S)-6-[(2S)-butan-2-yl]-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 54713658 |
| Molecular Formula | C22H23F2N3O5 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (3R,6S)-6-[(2S)-butan-2-yl]-N-[(2,4-difluorophenyl)methyl]-10-hydroxy-8,11-dioxo-4-oxa-1,7-diazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | CC[C@H](C)[C@H]1CO[C@@H]2Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N12 |
| InChI | InChI=1S/C22H23F2N3O5/c1-3-11(2)16-10-32-17-9-26-8-14(19(28)20(29)18(26)22(31)27(16)17)21(30)25-7-12-4-5-13(23)6-15(12)24/h4-6,8,11,16-17,29H,3,7,9-10H2,1-2H3,(H,25,30)/t11-,16+,17+/m0/s1 |
| InChIKey | CIXQWCOTGLIZAZ-YMRXKLBXSA-N |
| XLogP | 1.99 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |