C28H29NO3 — CID 54713785
3-[[3-(benzylideneamino)phenyl]-cyclopropylmethyl]-4-hydroxy-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one (PubChem CID 54713785) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is 3-[[3-(benzylideneamino)phenyl]-cyclopropylmethyl]-4-hydroxy-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one.
| Compound Name | 3-[[3-(benzylideneamino)phenyl]-cyclopropylmethyl]-4-hydroxy-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one |
|---|---|
| PubChem CID | 54713785 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 3-[[3-(benzylideneamino)phenyl]-cyclopropylmethyl]-4-hydroxy-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-2-one |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(/N=C/c3ccccc3)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C28H29NO3/c30-27-23-13-6-1-2-7-14-24(23)32-28(31)26(27)25(20-15-16-20)21-11-8-12-22(17-21)29-18-19-9-4-3-5-10-19/h3-5,8-12,17-18,20,25,30H,1-2,6-7,13-16H2/b29-18+ |
| InChIKey | RJJHAUKMHNONHF-RDRPBHBLSA-N |
| XLogP | 6.30 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|