C15H20O3 — CID 5471440
(3aR,6E,10E,11aR)-3a-hydroxy-6,10-dimethyl-3-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2-one (PubChem CID 5471440) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3aR,6E,10E,11aR)-3a-hydroxy-6,10-dimethyl-3-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2-one.
| Compound Name | (3aR,6E,10E,11aR)-3a-hydroxy-6,10-dimethyl-3-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 5471440 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3aR,6E,10E,11aR)-3a-hydroxy-6,10-dimethyl-3-methylidene-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\C)CC[C@@]12O |
| InChI | InChI=1S/C15H20O3/c1-10-5-4-6-11(2)9-13-15(17,8-7-10)12(3)14(16)18-13/h5,9,13,17H,3-4,6-8H2,1-2H3/b10-5+,11-9+/t13-,15-/m1/s1 |
| InChIKey | AZKRCCHLNBJNOK-HZAIZTQPSA-N |
| XLogP | 2.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|