C16H16O5 — CID 5471461
[(1R,2R,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] acetate (PubChem CID 5471461) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is [(1R,2R,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] acetate.
| Compound Name | [(1R,2R,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] acetate |
|---|---|
| PubChem CID | 5471461 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [(1R,2R,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] acetate |
| SMILES | CC#CC#C/C=C1/O[C@]2(CCC(OC(C)=O)CO2)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C16H16O5/c1-3-4-5-6-7-13-14-15(20-14)16(21-13)9-8-12(10-18-16)19-11(2)17/h7,12,14-15H,8-10H2,1-2H3/b13-7+/t12?,14-,15-,16-/m1/s1 |
| InChIKey | ZDCLDOZKWHHBMR-JQCRUYAESA-N |
| XLogP | 1.13 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|