C18H24O7 — CID 54715116
trimethyl (5Z,7E)-5-hydroxy-3a-methyl-1,2,3,4,9,9a-hexahydrocyclopenta[8]annulene-1,6,7-tricarboxylate (PubChem CID 54715116) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is trimethyl (5Z,7E)-5-hydroxy-3a-methyl-1,2,3,4,9,9a-hexahydrocyclopenta[8]annulene-1,6,7-tricarboxylate.
| Compound Name | trimethyl (5Z,7E)-5-hydroxy-3a-methyl-1,2,3,4,9,9a-hexahydrocyclopenta[8]annulene-1,6,7-tricarboxylate |
|---|---|
| PubChem CID | 54715116 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | trimethyl (5Z,7E)-5-hydroxy-3a-methyl-1,2,3,4,9,9a-hexahydrocyclopenta[8]annulene-1,6,7-tricarboxylate |
| SMILES | COC(=O)C1=C(\O)CC2(C)CCC(C(=O)OC)C2C/C=C\1C(=O)OC |
| InChI | InChI=1S/C18H24O7/c1-18-8-7-10(15(20)23-2)12(18)6-5-11(16(21)24-3)14(13(19)9-18)17(22)25-4/h5,10,12,19H,6-9H2,1-4H3/b11-5+,14-13- |
| InChIKey | DUFOOXBFUWJHHD-LDQZXZHVSA-N |
| XLogP | 2.07 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|