C15H15ClN3O4S- — CID 54715494
4-[(E)-2-carboxy-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-2-chloro-6-methoxyphenolate (PubChem CID 54715494) has the molecular formula C15H15ClN3O4S- and a molecular weight of 368.82 g/mol. Its IUPAC name is 4-[(E)-2-carboxy-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-2-chloro-6-methoxyphenolate.
| Compound Name | 4-[(E)-2-carboxy-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-2-chloro-6-methoxyphenolate |
|---|---|
| PubChem CID | 54715494 |
| Molecular Formula | C15H15ClN3O4S- |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 4-[(E)-2-carboxy-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethenyl]-2-chloro-6-methoxyphenolate |
| SMILES | CCCc1nc(S/C(=C/c2cc(Cl)c([O-])c(OC)c2)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C15H16ClN3O4S/c1-3-4-12-17-15(19-18-12)24-11(14(21)22)7-8-5-9(16)13(20)10(6-8)23-2/h5-7,20H,3-4H2,1-2H3,(H,21,22)(H,17,18,19)/p-1/b11-7+ |
| InChIKey | OBASGPSBKJZVGU-YRNVUSSQSA-M |
| XLogP | 2.71 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|