C32H26N4O4S — CID 5471551
(5Z)-2-phenyl-3-(6-phenylsulfanyl-1H-benzimidazol-2-yl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one (PubChem CID 5471551) has the molecular formula C32H26N4O4S and a molecular weight of 562.65 g/mol. Its IUPAC name is (5Z)-2-phenyl-3-(6-phenylsulfanyl-1H-benzimidazol-2-yl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one.
| Compound Name | (5Z)-2-phenyl-3-(6-phenylsulfanyl-1H-benzimidazol-2-yl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 5471551 |
| Molecular Formula | C32H26N4O4S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | (5Z)-2-phenyl-3-(6-phenylsulfanyl-1H-benzimidazol-2-yl)-5-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-4-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccccc3)N(c3nc4ccc(Sc5ccccc5)cc4[nH]3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C32H26N4O4S/c1-38-27-17-20(18-28(39-2)29(27)40-3)16-26-31(37)36(30(33-26)21-10-6-4-7-11-21)32-34-24-15-14-23(19-25(24)35-32)41-22-12-8-5-9-13-22/h4-19H,1-3H3,(H,34,35)/b26-16- |
| InChIKey | JUSZXHXJDYIXKG-QQXSKIMKSA-N |
| XLogP | 6.57 |
| TPSA | 89.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|