C16H23N3O3 — CID 547159
3-[2-(dimethylamino)ethyl]-5-(4-ethoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 547159) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-5-(4-ethoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(dimethylamino)ethyl]-5-(4-ethoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 547159 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-5-(4-ethoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCOc1ccc(C2(C)NC(=O)N(CCN(C)C)C2=O)cc1 |
| InChI | InChI=1S/C16H23N3O3/c1-5-22-13-8-6-12(7-9-13)16(2)14(20)19(15(21)17-16)11-10-18(3)4/h6-9H,5,10-11H2,1-4H3,(H,17,21) |
| InChIKey | CTEFURXZJGDQNP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|