About methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate
methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate (PubChem CID 54717110) has the molecular formula C8H6ClNO5S2
and a molecular weight of 295.73 g/mol. Its IUPAC name is methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate |
| PubChem CID | 54717110 |
| Molecular Formula | C8H6ClNO5S2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 294.94 |
| IUPAC Name | methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate |
| SMILES | COC(=O)C1=C(O)c2csc(Cl)c2S(=O)(=O)N1 |
| InChI | InChI=1S/C8H6ClNO5S2/c1-15-8(12)4-5(11)3-2-16-7(9)6(3)17(13,14)10-4/h2,10-11H,1H3 |
| InChIKey | SMMQPPXVECBSSA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate?
The IUPAC name of methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate (CID 54717110) is methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate.
What is the SMILES notation for methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate?
The canonical SMILES for methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate is COC(=O)C1=C(O)c2csc(Cl)c2S(=O)(=O)N1.
What is the InChIKey of methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate?
The InChIKey is SMMQPPXVECBSSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO5S2/c1-15-8(12)4-5(11)3-2-16-7(9)6(3)17(13,14)10-4/h2,10-11H,1H3.
What are the key properties of methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate?
methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate has a molecular weight of 295.73 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-chloro-4-hydroxy-1,1-dioxo-2H-thieno[3,4-e]thiazine-3-carboxylate is sourced from PubChem (CID 54717110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).