C21H21FN4O5 — CID 54717526
N-[[4-fluoro-2-(3-methyl-1,2-oxazol-5-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide (PubChem CID 54717526) has the molecular formula C21H21FN4O5 and a molecular weight of 428.42 g/mol. Its IUPAC name is N-[[4-fluoro-2-(3-methyl-1,2-oxazol-5-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide.
| Compound Name | N-[[4-fluoro-2-(3-methyl-1,2-oxazol-5-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 54717526 |
| Molecular Formula | C21H21FN4O5 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[[4-fluoro-2-(3-methyl-1,2-oxazol-5-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide |
| SMILES | Cc1cc(-c2cc(F)ccc2CNC(=O)c2nc3n(c(=O)c2O)CCOC3(C)C)on1 |
| InChI | InChI=1S/C21H21FN4O5/c1-11-8-15(31-25-11)14-9-13(22)5-4-12(14)10-23-18(28)16-17(27)19(29)26-6-7-30-21(2,3)20(26)24-16/h4-5,8-9,27H,6-7,10H2,1-3H3,(H,23,28) |
| InChIKey | DHTVIFLCTQNNNM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |