About (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one
(5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one (PubChem CID 5471774) has the molecular formula C23H15N3O2S
and a molecular weight of 397.46 g/mol. Its IUPAC name is (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one.
Molecular Properties
| Compound Name | (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one |
| PubChem CID | 5471774 |
| Molecular Formula | C23H15N3O2S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one |
| SMILES | O=C1/C(=C/c2ccccc2O)N=C(c2ccccc2)N1c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H15N3O2S/c27-19-12-6-4-10-16(19)14-18-22(28)26(21(24-18)15-8-2-1-3-9-15)23-25-17-11-5-7-13-20(17)29-23/h1-14,27H/b18-14- |
| InChIKey | DYLJLIMKVLNIJW-JXAWBTAJSA-N |
| XLogP | 4.84 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one?
The IUPAC name of (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one (CID 5471774) is (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one.
What is the SMILES notation for (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one?
The canonical SMILES for (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one is O=C1/C(=C/c2ccccc2O)N=C(c2ccccc2)N1c1nc2ccccc2s1.
What is the InChIKey of (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one?
The InChIKey is DYLJLIMKVLNIJW-JXAWBTAJSA-N. The full InChI is InChI=1S/C23H15N3O2S/c27-19-12-6-4-10-16(19)14-18-22(28)26(21(24-18)15-8-2-1-3-9-15)23-25-17-11-5-7-13-20(17)29-23/h1-14,27H/b18-14-.
What are the key properties of (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one?
(5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one has a molecular weight of 397.46 g/mol, XLogP of 4.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3-(1,3-benzothiazol-2-yl)-5-[(2-hydroxyphenyl)methylidene]-2-phenylimidazol-4-one is sourced from PubChem (CID 5471774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).