About 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one
1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one (PubChem CID 54717823) has the molecular formula C17H14Cl2N2O3
and a molecular weight of 365.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one |
| PubChem CID | 54717823 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one |
| SMILES | CC(O)Cc1c(O)c2cccnc2n(-c2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-9(22)7-12-15(23)11-3-2-6-20-16(11)21(17(12)24)10-4-5-13(18)14(19)8-10/h2-6,8-9,22-23H,7H2,1H3 |
| InChIKey | GUBSCLFGBKQPKT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one?
The IUPAC name of 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one (CID 54717823) is 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one?
The canonical SMILES for 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one is CC(O)Cc1c(O)c2cccnc2n(-c2ccc(Cl)c(Cl)c2)c1=O.
What is the InChIKey of 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one?
The InChIKey is GUBSCLFGBKQPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2N2O3/c1-9(22)7-12-15(23)11-3-2-6-20-16(11)21(17(12)24)10-4-5-13(18)14(19)8-10/h2-6,8-9,22-23H,7H2,1H3.
What are the key properties of 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one?
1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one has a molecular weight of 365.22 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-4-hydroxy-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one is sourced from PubChem (CID 54717823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).