About (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one
(Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one (PubChem CID 5471823) has the molecular formula C6H8F3NO2S
and a molecular weight of 215.20 g/mol. Its IUPAC name is (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one.
Molecular Properties
| Compound Name | (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one |
| PubChem CID | 5471823 |
| Molecular Formula | C6H8F3NO2S |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one |
| SMILES | CS(C)(=O)=N/C=C\C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F3NO2S/c1-13(2,12)10-4-3-5(11)6(7,8)9/h3-4H,1-2H3/b4-3- |
| InChIKey | VFTCZTHAHOHIAI-ARJAWSKDSA-N |
| XLogP | 1.36 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one?
The IUPAC name of (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one (CID 5471823) is (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one.
What is the SMILES notation for (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one?
The canonical SMILES for (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one is CS(C)(=O)=N/C=C\C(=O)C(F)(F)F.
What is the InChIKey of (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one?
The InChIKey is VFTCZTHAHOHIAI-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H8F3NO2S/c1-13(2,12)10-4-3-5(11)6(7,8)9/h3-4H,1-2H3/b4-3-.
What are the key properties of (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one?
(Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one has a molecular weight of 215.20 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-1,1,1-trifluorobut-3-en-2-one is sourced from PubChem (CID 5471823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).