C28H27N3O5 — CID 54718272
(4R,4aS,7aR,12bS)-N-(4-cyanophenyl)-3-(cyclopropylmethyl)-4a,7,9-trihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide (PubChem CID 54718272) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-N-(4-cyanophenyl)-3-(cyclopropylmethyl)-4a,7,9-trihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide.
| Compound Name | (4R,4aS,7aR,12bS)-N-(4-cyanophenyl)-3-(cyclopropylmethyl)-4a,7,9-trihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 54718272 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (4R,4aS,7aR,12bS)-N-(4-cyanophenyl)-3-(cyclopropylmethyl)-4a,7,9-trihydroxy-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-6-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)C2=C(O)[C@@H]3Oc4c(O)ccc5c4[C@@]34CCN(CC3CC3)[C@H](C5)[C@]4(O)C2)cc1 |
| InChI | InChI=1S/C28H27N3O5/c29-13-15-3-6-18(7-4-15)30-26(34)19-12-28(35)21-11-17-5-8-20(32)24-22(17)27(28,25(36-24)23(19)33)9-10-31(21)14-16-1-2-16/h3-8,16,21,25,32-33,35H,1-2,9-12,14H2,(H,30,34)/t21-,25+,27+,28-/m1/s1 |
| InChIKey | LVONLGQOYIILGN-NZHOUOPXSA-N |
| XLogP | 2.89 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |