C26H38O10 — CID 54719019
2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(E)-7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid (PubChem CID 54719019) has the molecular formula C26H38O10 and a molecular weight of 510.58 g/mol. Its IUPAC name is 2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(E)-7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid.
| Compound Name | 2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(E)-7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54719019 |
| Molecular Formula | C26H38O10 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;(E)-7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxocyclopenten-1-yl]hept-5-enoic acid |
| SMILES | CCCCCC(O)/C=C/C1=C(C/C=C/CCCC(=O)O)C(=O)CC1.O=C1OC([C@@H](O)CO)C(O)=C1O |
| InChI | InChI=1S/C20H30O4.C6H8O6/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24;7-1-2(8)5-3(9)4(10)6(11)12-5/h4,7,12,14,17,21H,2-3,5-6,8-11,13,15H2,1H3,(H,23,24);2,5,7-10H,1H2/b7-4+,14-12+;/t;2-,5?/m.0/s1 |
| InChIKey | PAZBJQRIQDIEQH-YZUDGFIWSA-N |
| XLogP | 2.94 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|