About dilithium;3-carboxy-4-oxidobenzenesulfonate
dilithium;3-carboxy-4-oxidobenzenesulfonate (PubChem CID 54719020) has the molecular formula C7H4Li2O6S
and a molecular weight of 230.05 g/mol. Its IUPAC name is dilithium;3-carboxy-4-oxidobenzenesulfonate.
Molecular Properties
| Compound Name | dilithium;3-carboxy-4-oxidobenzenesulfonate |
| PubChem CID | 54719020 |
| Molecular Formula | C7H4Li2O6S |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | dilithium;3-carboxy-4-oxidobenzenesulfonate |
| SMILES | O=C(O)c1cc(S(=O)(=O)[O-])ccc1[O-].[Li+].[Li+] |
| InChI | InChI=1S/C7H6O6S.2Li/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;/h1-3,8H,(H,9,10)(H,11,12,13);;/q;2*+1/p-2 |
| InChIKey | DUXKCDAVBBPHEQ-UHFFFAOYSA-L |
| XLogP | -6.63 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | -6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dilithium;3-carboxy-4-oxidobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;3-carboxy-4-oxidobenzenesulfonate?
The IUPAC name of dilithium;3-carboxy-4-oxidobenzenesulfonate (CID 54719020) is dilithium;3-carboxy-4-oxidobenzenesulfonate.
What is the SMILES notation for dilithium;3-carboxy-4-oxidobenzenesulfonate?
The canonical SMILES for dilithium;3-carboxy-4-oxidobenzenesulfonate is O=C(O)c1cc(S(=O)(=O)[O-])ccc1[O-].[Li+].[Li+].
What is the InChIKey of dilithium;3-carboxy-4-oxidobenzenesulfonate?
The InChIKey is DUXKCDAVBBPHEQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O6S.2Li/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;/h1-3,8H,(H,9,10)(H,11,12,13);;/q;2*+1/p-2.
What are the key properties of dilithium;3-carboxy-4-oxidobenzenesulfonate?
dilithium;3-carboxy-4-oxidobenzenesulfonate has a molecular weight of 230.05 g/mol, XLogP of -6.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;3-carboxy-4-oxidobenzenesulfonate is sourced from PubChem (CID 54719020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).