C33H33N3O8S — CID 54719152
4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719152) has the molecular formula C33H33N3O8S and a molecular weight of 631.71 g/mol. Its IUPAC name is 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719152 |
| Molecular Formula | C33H33N3O8S |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | 4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-9-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | Cc1sc(Cc2ccc3c(c2O)C(O)=C2C(=O)C4(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C4C(O)C2C3C)nc1-c1ccccc1 |
| InChI | InChI=1S/C33H33N3O8S/c1-13-17-11-10-16(12-18-35-24(14(2)45-18)15-8-6-5-7-9-15)26(37)20(17)27(38)21-19(13)28(39)23-25(36(3)4)29(40)22(32(34)43)31(42)33(23,44)30(21)41/h5-11,13,19,23,25,28,37-39,42,44H,12H2,1-4H3,(H2,34,43) |
| InChIKey | ZLYZCVCEAZYXIO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 194.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|