C30H27FN4O7S — CID 54719177
4-(dimethylamino)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719177) has the molecular formula C30H27FN4O7S and a molecular weight of 606.63 g/mol. Its IUPAC name is 4-(dimethylamino)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719177 |
| Molecular Formula | C30H27FN4O7S |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 4-(dimethylamino)-9-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(ccc(Nc5nc(-c6ccc(F)cc6)cs5)c4O)CC3CC12 |
| InChI | InChI=1S/C30H27FN4O7S/c1-35(2)22-16-10-14-9-13-5-8-17(33-29-34-18(11-43-29)12-3-6-15(31)7-4-12)23(36)19(13)24(37)20(14)26(39)30(16,42)27(40)21(25(22)38)28(32)41/h3-8,11,14,16,22,36-37,40,42H,9-10H2,1-2H3,(H2,32,41)(H,33,34) |
| InChIKey | HGTPUKRGFSKSJB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 186.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|