C28H31N5O9 — CID 54719252
N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide (PubChem CID 54719252) has the molecular formula C28H31N5O9 and a molecular weight of 581.58 g/mol. Its IUPAC name is N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 54719252 |
| Molecular Formula | C28H31N5O9 |
| Molecular Weight | 581.58 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)c1cc(CNC(=O)c2ccno2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H31N5O9/c1-32(2)15-9-12(10-30-27(40)16-5-6-31-42-16)21(34)18-13(15)7-11-8-14-20(33(3)4)23(36)19(26(29)39)25(38)28(14,41)24(37)17(11)22(18)35/h5-6,9,11,14,20,34-35,38,41H,7-8,10H2,1-4H3,(H2,29,39)(H,30,40) |
| InChIKey | ZERDJUJWWSFOAS-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 219.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.58 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|