C25H24N4O9 — CID 54719253
N-[9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 54719253) has the molecular formula C25H24N4O9 and a molecular weight of 524.49 g/mol. Its IUPAC name is N-[9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 54719253 |
| Molecular Formula | C25H24N4O9 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | N-[9-carbamoyl-7-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(ccc(NC(=O)c5ccno5)c4O)CC3CC12 |
| InChI | InChI=1S/C25H24N4O9/c1-29(2)17-11-8-10-7-9-3-4-12(28-24(36)13-5-6-27-38-13)18(30)14(9)19(31)15(10)21(33)25(11,37)22(34)16(20(17)32)23(26)35/h3-6,10-11,17,30-31,34,37H,7-8H2,1-2H3,(H2,26,35)(H,28,36) |
| InChIKey | WJWSRYCYTZXXMJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 216.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|