C28H30O8 — CID 54719278
ethyl (2E,4Z,6E)-7-(3,4-dimethoxyphenyl)-4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-5-hydroxyhepta-2,4,6-trienoate (PubChem CID 54719278) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is ethyl (2E,4Z,6E)-7-(3,4-dimethoxyphenyl)-4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-5-hydroxyhepta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4Z,6E)-7-(3,4-dimethoxyphenyl)-4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-5-hydroxyhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 54719278 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | ethyl (2E,4Z,6E)-7-(3,4-dimethoxyphenyl)-4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-5-hydroxyhepta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C/C(C(=O)/C=C/c1ccc(OC)c(OC)c1)=C(O)\C=C\c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H30O8/c1-6-36-28(31)16-11-21(22(29)12-7-19-9-14-24(32-2)26(17-19)34-4)23(30)13-8-20-10-15-25(33-3)27(18-20)35-5/h7-18,29H,6H2,1-5H3/b12-7+,13-8+,16-11+,22-21- |
| InChIKey | IXCWTLNAVFRHMT-IUAKWNNOSA-N |
| XLogP | 4.95 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|