C25H48O3Si — CID 5471931
(6R,11Z,13S)-6-hydroxy-2-methyl-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one (PubChem CID 5471931) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is (6R,11Z,13S)-6-hydroxy-2-methyl-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one.
| Compound Name | (6R,11Z,13S)-6-hydroxy-2-methyl-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one |
|---|---|
| PubChem CID | 5471931 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | (6R,11Z,13S)-6-hydroxy-2-methyl-13-tri(propan-2-yl)silyloxypentadeca-2,11-dien-8-one |
| SMILES | CC[C@@H](/C=C\CCC(=O)C[C@H](O)CCC=C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H48O3Si/c1-10-25(28-29(20(4)5,21(6)7)22(8)9)17-12-11-15-23(26)18-24(27)16-13-14-19(2)3/h12,14,17,20-22,24-25,27H,10-11,13,15-16,18H2,1-9H3/b17-12-/t24-,25+/m1/s1 |
| InChIKey | FKLWVAQESZRPSK-BJWZYDGJSA-N |
| XLogP | 7.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|