C22H20O5S — CID 54720008
propan-2-yl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate (PubChem CID 54720008) has the molecular formula C22H20O5S and a molecular weight of 396.46 g/mol. Its IUPAC name is propan-2-yl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate.
| Compound Name | propan-2-yl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 54720008 |
| Molecular Formula | C22H20O5S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | propan-2-yl 2-[(4-hydroxy-2-oxo-6-phenylpyran-3-yl)sulfanylmethyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccccc1CSc1c(O)cc(-c2ccccc2)oc1=O |
| InChI | InChI=1S/C22H20O5S/c1-14(2)26-21(24)17-11-7-6-10-16(17)13-28-20-18(23)12-19(27-22(20)25)15-8-4-3-5-9-15/h3-12,14,23H,13H2,1-2H3 |
| InChIKey | OFYLNXRFGPWUMR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |