C15H24IN3O3 — CID 54720053
2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl-trimethylazanium iodide (PubChem CID 54720053) has the molecular formula C15H24IN3O3 and a molecular weight of 421.28 g/mol. Its IUPAC name is 2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl-trimethylazanium iodide.
| Compound Name | 2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 54720053 |
| Molecular Formula | C15H24IN3O3 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 2-[(4-hydroxy-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carbonyl)amino]ethyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCNC(=O)c1c(O)c2c([nH]c1=O)CCCC2.[I-] |
| InChI | InChI=1S/C15H23N3O3.HI/c1-18(2,3)9-8-16-14(20)12-13(19)10-6-4-5-7-11(10)17-15(12)21;/h4-9H2,1-3H3,(H2-,16,17,19,20,21);1H |
| InChIKey | JGIIFUVIEASKPA-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|