C28H32NO2+ — CID 5472008
(3S,5S)-4-benzyl-3,5-bis(2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium (PubChem CID 5472008) has the molecular formula C28H32NO2+ and a molecular weight of 414.57 g/mol. Its IUPAC name is (3S,5S)-4-benzyl-3,5-bis(2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium.
| Compound Name | (3S,5S)-4-benzyl-3,5-bis(2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
|---|---|
| PubChem CID | 5472008 |
| Molecular Formula | C28H32NO2+ |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (3S,5S)-4-benzyl-3,5-bis(2-methoxyphenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium |
| SMILES | COc1ccccc1[C@@H]1CCC2CC[C@@H](c3ccccc3OC)[N+]21Cc1ccccc1 |
| InChI | InChI=1S/C28H32NO2/c1-30-27-14-8-6-12-23(27)25-18-16-22-17-19-26(24-13-7-9-15-28(24)31-2)29(22,25)20-21-10-4-3-5-11-21/h3-15,22,25-26H,16-20H2,1-2H3/q+1/t22?,25-,26-,29?/m0/s1 |
| InChIKey | QXAOBRNWGOLTMU-BQXZNZDXSA-N |
| XLogP | 6.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|