About 6-bromo-1H-3,1-benzothiazine-2,4-dithione
6-bromo-1H-3,1-benzothiazine-2,4-dithione (PubChem CID 5472017) has the molecular formula C8H4BrNS3
and a molecular weight of 290.23 g/mol. Its IUPAC name is 6-bromo-1H-3,1-benzothiazine-2,4-dithione.
Molecular Properties
| Compound Name | 6-bromo-1H-3,1-benzothiazine-2,4-dithione |
| PubChem CID | 5472017 |
| Molecular Formula | C8H4BrNS3 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 288.87 |
| IUPAC Name | 6-bromo-1H-3,1-benzothiazine-2,4-dithione |
| SMILES | S=c1[nH]c2ccc(Br)cc2c(=S)s1 |
| InChI | InChI=1S/C8H4BrNS3/c9-4-1-2-6-5(3-4)7(11)13-8(12)10-6/h1-3H,(H,10,12) |
| InChIKey | RVXQTHWTKITLDI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-3,1-benzothiazine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-3,1-benzothiazine-2,4-dithione?
The IUPAC name of 6-bromo-1H-3,1-benzothiazine-2,4-dithione (CID 5472017) is 6-bromo-1H-3,1-benzothiazine-2,4-dithione.
What is the SMILES notation for 6-bromo-1H-3,1-benzothiazine-2,4-dithione?
The canonical SMILES for 6-bromo-1H-3,1-benzothiazine-2,4-dithione is S=c1[nH]c2ccc(Br)cc2c(=S)s1.
What is the InChIKey of 6-bromo-1H-3,1-benzothiazine-2,4-dithione?
The InChIKey is RVXQTHWTKITLDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrNS3/c9-4-1-2-6-5(3-4)7(11)13-8(12)10-6/h1-3H,(H,10,12).
What are the key properties of 6-bromo-1H-3,1-benzothiazine-2,4-dithione?
6-bromo-1H-3,1-benzothiazine-2,4-dithione has a molecular weight of 290.23 g/mol, XLogP of 4.45, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-3,1-benzothiazine-2,4-dithione is sourced from PubChem (CID 5472017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).