About 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one
1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one (PubChem CID 54720270) has the molecular formula C14H10N2O4
and a molecular weight of 270.24 g/mol. Its IUPAC name is 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one |
| PubChem CID | 54720270 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one |
| SMILES | O=c1cc(O)c2c(-c3cccc(O)c3)ccnc2n1O |
| InChI | InChI=1S/C14H10N2O4/c17-9-3-1-2-8(6-9)10-4-5-15-14-13(10)11(18)7-12(19)16(14)20/h1-7,17-18,20H |
| InChIKey | XXPANNKSAKZISR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one?
The IUPAC name of 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one (CID 54720270) is 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one.
What is the SMILES notation for 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one?
The canonical SMILES for 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one is O=c1cc(O)c2c(-c3cccc(O)c3)ccnc2n1O.
What is the InChIKey of 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one?
The InChIKey is XXPANNKSAKZISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O4/c17-9-3-1-2-8(6-9)10-4-5-15-14-13(10)11(18)7-12(19)16(14)20/h1-7,17-18,20H.
What are the key properties of 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one?
1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one has a molecular weight of 270.24 g/mol, XLogP of 1.71, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydroxy-5-(3-hydroxyphenyl)-1,8-naphthyridin-2-one is sourced from PubChem (CID 54720270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).