C26H26Cl3N3O3 — CID 547204
[7-chloro-3-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propylimino]-9-oxo-2,3,4,10-tetrahydroacridin-4-yl] acetate (PubChem CID 547204) has the molecular formula C26H26Cl3N3O3 and a molecular weight of 534.87 g/mol. Its IUPAC name is [7-chloro-3-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propylimino]-9-oxo-2,3,4,10-tetrahydroacridin-4-yl] acetate.
| Compound Name | [7-chloro-3-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propylimino]-9-oxo-2,3,4,10-tetrahydroacridin-4-yl] acetate |
|---|---|
| PubChem CID | 547204 |
| Molecular Formula | C26H26Cl3N3O3 |
| Molecular Weight | 534.87 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | [7-chloro-3-(2,4-dichlorophenyl)-1-[3-(dimethylamino)propylimino]-9-oxo-2,3,4,10-tetrahydroacridin-4-yl] acetate |
| SMILES | CC(=O)OC1c2[nH]c3ccc(Cl)cc3c(=O)c2/C(=N/CCCN(C)C)CC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H26Cl3N3O3/c1-14(33)35-26-18(17-7-5-16(28)12-20(17)29)13-22(30-9-4-10-32(2)3)23-24(26)31-21-8-6-15(27)11-19(21)25(23)34/h5-8,11-12,18,26H,4,9-10,13H2,1-3H3,(H,31,34)/b30-22+ |
| InChIKey | GJZFLJHGUCYBLJ-JBASAIQMSA-N |
| XLogP | 6.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.87 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|