C29H40N2O — CID 5472144
(3S,8R,9S,10R,13S,14S,16E,17S)-10,13-dimethyl-16-(pyridin-4-ylmethylidene)-3-pyrrolidin-1-yl-1,2,3,6,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 5472144) has the molecular formula C29H40N2O and a molecular weight of 432.65 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,16E,17S)-10,13-dimethyl-16-(pyridin-4-ylmethylidene)-3-pyrrolidin-1-yl-1,2,3,6,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,16E,17S)-10,13-dimethyl-16-(pyridin-4-ylmethylidene)-3-pyrrolidin-1-yl-1,2,3,6,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 5472144 |
| Molecular Formula | C29H40N2O |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,16E,17S)-10,13-dimethyl-16-(pyridin-4-ylmethylidene)-3-pyrrolidin-1-yl-1,2,3,6,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=C[C@@H](N5CCCC5)CC[C@@]43C)[C@@H]1C/C(=C\c1ccncc1)[C@@H]2O |
| InChI | InChI=1S/C29H40N2O/c1-28-11-7-23(31-15-3-4-16-31)19-22(28)5-6-24-25(28)8-12-29(2)26(24)18-21(27(29)32)17-20-9-13-30-14-10-20/h9-10,13-14,17,19,23-27,32H,3-8,11-12,15-16,18H2,1-2H3/b21-17+/t23-,24+,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | SEMWNMDNLBLNSK-RKXRPQCWSA-N |
| XLogP | 5.86 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|